Final answer:The true statement about the carbocation represented by the SMILES string is that it would rearrange via a hydride shift to give a tertiary carbocation, demonstrating the natural tendency of carbocations to rearrange towards a more stable state. Therefore, b) The carbocation would rearrange via a hydride shift to give a tertiary carbocation is correct option.Explanation:Select the true statement about the carbocation shown. A bond line structure with SMILES string CC1(C)CCCCC(C)(C)[CH+]1.The correct answer to this question is that the carbocation would rearrange via a hydride shift to give a tertiary carbocation. In the process of carbocation rearrangement, particularly when involving a secondary carbocation adjacent to a tertiary carbon center, a hydride transfer often occurs to form a more stable tertiary carbocation. This phenomenon is rooted in the principle that carbocations will rearrange to become more stable if possible, which in many cases involves a shift from a less stable secondary carbocation to a more stable tertiary carbocation through a 1,2-hydride shift. This process essentially involves the electrons in the bond between a hydrogen atom and its adjacent carbon being attracted by the positive charge on the carbocation, facilitating the migration of the hydrogen (and its bonding electrons) to fill the carbocation's empty p orbital, thereby stabilizing it.Thus, the statement "The carbocation would rearrange via a hydride shift to give a tertiary carbocation" is true, as it aligns with the general understanding of carbocation rearrangements in organic chemistry, emphasizing the tendency of molecules to reach a more stable state through rearrangement processes such as the 1,2-hydride shift....

Unlock to view answer

Unlock full access for 72 hours, watch your grades skyrocket.

For just $0.99 cents, get access to the powerful quizwhiz chrome extension that automatically solves your homework using AI. Subscription renews at $5.99/week.